Products 77820-32-7

CAS 77820-32-7 is the registry number for 2,3-Dibromo-3-(p-methoxyl)phenyl Propionic Acid. Offered by: TRC. Available pack sizes: 2,5g, 25g.

Structural formula: {0} (CAS {1})

2,3-dibromo-3-(4-methoxyphenyl)propanoic acid (CAS 77820-32-7) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: 2,3-dibromo-3-(4-methoxyphenyl)propanoic acid. InChIKey: MWJORQFVICKTJV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10Br2O3
Molecular weight337.99 g/mol
IUPAC name2,3-dibromo-3-(4-methoxyphenyl)propanoic acid
InChIKeyMWJORQFVICKTJV-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C(C(C(=O)O)Br)Br

Computed by PubChem (NCBI)