CAS 77820-32-7 is the registry number for 2,3-Dibromo-3-(p-methoxyl)phenyl Propionic Acid. Offered by: TRC. Available pack sizes: 2,5g, 25g.
2,3-dibromo-3-(4-methoxyphenyl)propanoic acid (CAS 77820-32-7) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: 2,3-dibromo-3-(4-methoxyphenyl)propanoic acid. InChIKey: MWJORQFVICKTJV-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O3 |
|---|---|
| Molecular weight | 337.99 g/mol |
| IUPAC name | 2,3-dibromo-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | MWJORQFVICKTJV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(C(=O)O)Br)Br |
Computed by PubChem (NCBI)