CAS 107558-26-9 is the registry number for Methyl 3-(4-nitrophenyl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 3-(4-nitrophenyl)benzoate (CAS 107558-26-9) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: methyl 3-(4-nitrophenyl)benzoate. InChIKey: GKHTYTPKNDUBMT-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | methyl 3-(4-nitrophenyl)benzoate |
| InChIKey | GKHTYTPKNDUBMT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)