Products 107575-59-7
CAS 107575-59-7 appears in our catalog under these names: Pyrroloquinoline Impurity 3, Pyrroloquinoline Impurity 4, Ethyl Pyruvate-3-formylamino-4-methoxyphenylhydrazone. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (2E)-2-[(3-formamido-4-methoxyphenyl)hydrazinylidene]propanoate (CAS 107575-59-7) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: ethyl (2E)-2-[(3-formamido-4-methoxyphenyl)hydrazinylidene]propanoate. InChIKey: FCTPJLPLVYPRIA-OQLLNIDSSA-N.
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | ethyl (2E)-2-[(3-formamido-4-methoxyphenyl)hydrazinylidene]propanoate |
| InChIKey | FCTPJLPLVYPRIA-OQLLNIDSSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC(=C(C=C1)OC)NC=O)/C |
Computed by PubChem (NCBI)