Products 886631-29-4

CAS 886631-29-4 is the registry number for Ethyl 3-nitro-4-piperazin-1-ylbenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Ethyl 3-nitro-4-piperazin-1-ylbenzoate (CAS 886631-29-4) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: ethyl 3-nitro-4-piperazin-1-ylbenzoate. InChIKey: QAGYBERSNPLRAY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17N3O4
Molecular weight279.29 g/mol
IUPAC nameethyl 3-nitro-4-piperazin-1-ylbenzoate
InChIKeyQAGYBERSNPLRAY-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C=C1)N2CCNCC2)[N+](=O)[O-]

Computed by PubChem (NCBI)