Products 1309037-26-0
CAS 1309037-26-0 is the registry number for N2-[(Benzylamino)carbonyl]-l-glutamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-5-amino-2-(benzylcarbamoylamino)-5-oxopentanoic acid (CAS 1309037-26-0) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: (2S)-5-amino-2-(benzylcarbamoylamino)-5-oxopentanoic acid. InChIKey: BZAOKHUDPLJHHD-JTQLQIEISA-N.
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (2S)-5-amino-2-(benzylcarbamoylamino)-5-oxopentanoic acid |
| InChIKey | BZAOKHUDPLJHHD-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)N[C@@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)