Products 1951444-72-6
CAS 1951444-72-6 is the registry number for 2,3-Dihydro-pyrazolo[3,4-c]pyridine-1,3-dicarboxylic acid 1-tert-butyl ester 3-methyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-O-tert-butyl 3-O-methyl 2,3-dihydropyrazolo[3,4-c]pyridine-1,3-dicarboxylate (CAS 1951444-72-6) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 2,3-dihydropyrazolo[3,4-c]pyridine-1,3-dicarboxylate. InChIKey: HRDHXHPOGCVEHC-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 2,3-dihydropyrazolo[3,4-c]pyridine-1,3-dicarboxylate |
| InChIKey | HRDHXHPOGCVEHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=CN=C2)C(N1)C(=O)OC |
Computed by PubChem (NCBI)