CAS 2124262-56-0 is the registry number for tert-Butyl (S)-(2-oxo-1,2,3,4-tetrahydropyrido[3,4-b][1,4]oxazepin-3-yl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3S)-2-oxo-3,4-dihydro-1H-pyrido[3,4-b][1,4]oxazepin-3-yl]carbamate (CAS 2124262-56-0) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: tert-butyl N-[(3S)-2-oxo-3,4-dihydro-1H-pyrido[3,4-b][1,4]oxazepin-3-yl]carbamate. InChIKey: UFYOBTNOIPYVDW-VIFPVBQESA-N.
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | tert-butyl N-[(3S)-2-oxo-3,4-dihydro-1H-pyrido[3,4-b][1,4]oxazepin-3-yl]carbamate |
| InChIKey | UFYOBTNOIPYVDW-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC2=C(C=CN=C2)NC1=O |
Computed by PubChem (NCBI)