CAS 1076199-26-2 appears in our catalog under these names: N-Nitroso akardite ii, 95%, N-Nitroso akardite II. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg.
1-methyl-1-nitroso-3,3-diphenylurea (CAS 1076199-26-2) is a chemical compound with the molecular formula C14H13N3O2 and a molecular weight of 255.27 g/mol. IUPAC name: 1-methyl-1-nitroso-3,3-diphenylurea. InChIKey: ZUXQWYQSFLIGFM-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O2 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 1-methyl-1-nitroso-3,3-diphenylurea |
| InChIKey | ZUXQWYQSFLIGFM-UHFFFAOYSA-N |
| SMILES | CN(C(=O)N(C1=CC=CC=C1)C2=CC=CC=C2)N=O |
Computed by PubChem (NCBI)