CAS 3718-00-1 appears in our catalog under these names: (2E)-1-N-Methyl-2-n-[(3-nitrophenyl)methylidene]benzene-1,2-diamine, 95%, 1-N-Methyl-2-N-((3-nitrophenyl)methylidene)benzene-1,2-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-methyl-2-[(3-nitrophenyl)methylideneamino]aniline (CAS 3718-00-1) is a chemical compound with the molecular formula C14H13N3O2 and a molecular weight of 255.27 g/mol. IUPAC name: N-methyl-2-[(3-nitrophenyl)methylideneamino]aniline. InChIKey: CYRZJTLDELRICR-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O2 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | N-methyl-2-[(3-nitrophenyl)methylideneamino]aniline |
| InChIKey | CYRZJTLDELRICR-UHFFFAOYSA-N |
| SMILES | CNC1=CC=CC=C1N=CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)