Products 96549-95-0

CAS 96549-95-0 is the registry number for 2-(2H-1,2,3-Benzotriazol-2-yl)-4-(2-hydroxyethyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenol (CAS 96549-95-0) is a chemical compound with the molecular formula C14H13N3O2 and a molecular weight of 255.27 g/mol. IUPAC name: 2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenol. InChIKey: CHKKZILXOJVMAD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13N3O2
Molecular weight255.27 g/mol
IUPAC name2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenol
InChIKeyCHKKZILXOJVMAD-UHFFFAOYSA-N
SMILESC1=CC2=NN(N=C2C=C1)C3=C(C=CC(=C3)CCO)O

Computed by PubChem (NCBI)