CAS 370866-00-5 appears in our catalog under these names: 1-(4-Methoxybenzyl)-1h-pyrazolo[3,4-b]pyridin-4-ol, 95%, 1-(4-Methoxybenzyl)-1H-pyrazolo(3,4-b)pyridin-4(7H)-one, 97%, 1-(4-Methoxybenzyl)-1H-pyrazolo[3,4-b]pyridin-4(7H)-one, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
1-[(4-methoxyphenyl)methyl]-7H-pyrazolo[5,4-b]pyridin-4-one (CAS 370866-00-5) is a chemical compound with the molecular formula C14H13N3O2 and a molecular weight of 255.27 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]-7H-pyrazolo[5,4-b]pyridin-4-one. InChIKey: XQBXNRCFGZPQLH-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O2 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]-7H-pyrazolo[5,4-b]pyridin-4-one |
| InChIKey | XQBXNRCFGZPQLH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C3=C(C=N2)C(=O)C=CN3 |
Computed by PubChem (NCBI)