CAS 77635-72-4 appears in our catalog under these names: (1E)-1-(4-Nitrophenyl)ethanone phenylhydrazone, 95%, 1-(1-(4-Nitrophenyl)ethylidene)-2-phenylhydrazine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
N-[(E)-1-(4-nitrophenyl)ethylideneamino]aniline (CAS 77635-72-4) is a chemical compound with the molecular formula C14H13N3O2 and a molecular weight of 255.27 g/mol. IUPAC name: N-[(E)-1-(4-nitrophenyl)ethylideneamino]aniline. InChIKey: VXRMHXXWRBMDFK-RVDMUPIBSA-N.
| Molecular formula | C14H13N3O2 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | N-[(E)-1-(4-nitrophenyl)ethylideneamino]aniline |
| InChIKey | VXRMHXXWRBMDFK-RVDMUPIBSA-N |
| SMILES | C/C(=N\NC1=CC=CC=C1)/C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)