CAS 107870-81-5 is the registry number for 4-Hydroxybutyryl-L-Carnitine. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-3-(4-hydroxybutanoyloxy)-4-(trimethylazaniumyl)butanoate (CAS 107870-81-5) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: (3R)-3-(4-hydroxybutanoyloxy)-4-(trimethylazaniumyl)butanoate. InChIKey: ZFJOZGQNTJRPDE-SECBINFHSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (3R)-3-(4-hydroxybutanoyloxy)-4-(trimethylazaniumyl)butanoate |
| InChIKey | ZFJOZGQNTJRPDE-SECBINFHSA-N |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)CCCO |
Computed by PubChem (NCBI)