Products 125945-98-4
CAS 125945-98-4 appears in our catalog under these names: Benzoic Acid-13C6, >95% (HPLC), Benzoic acid–13C6, BENZOIC ACID-RING-13C6, 99 ATOM % 13C, Benzoic acid-13C6, 99.66%. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 10mg, 250mg, 5mg, 500MG, 25 mg, 100 mg, 10 mg.
(1,2,3,4,5,6-13C6)cyclohexatrienecarboxylic acid (CAS 125945-98-4) is a chemical compound with the molecular formula C7H6O2 and a molecular weight of 128.077 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatrienecarboxylic acid. InChIKey: WPYMKLBDIGXBTP-IDEBNGHGSA-N.
| Molecular formula | C7H6O2 |
|---|---|
| Molecular weight | 128.077 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatrienecarboxylic acid |
| InChIKey | WPYMKLBDIGXBTP-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzoic Acid-13C6, Benzoic acid-ring-13C6, Benzoicacid-ring-ul-14c, (1,2,3,4,5,6-13C6)cyclohexatrienecarboxylic acid, Benzoic-1,2,3,4,5,6-13C6 acid; [Ring-U-13C]-benzoic acid; Benzoic Acid-13C6, starbld0016546, (~13~C_6_)Benzoic acid, orb2299650, Benzoic-1,2,3,4,5,6-13C6 acid, Benzoic acid-(phenyl-13C6), 99 atom % 13C