Products 406679-59-2

CAS 406679-59-2 is the registry number for BENZOIC ACID-D, 98 ATOM % D. Offered by: Sigma-Aldrich. Available pack sizes: 10G.

Structural formula: {0} (CAS {1})

Deuterio benzoate (CAS 406679-59-2) is a chemical compound with the molecular formula C7H6O2 and a molecular weight of 123.13 g/mol. IUPAC name: deuterio benzoate. InChIKey: WPYMKLBDIGXBTP-DYCDLGHISA-N.

Identity
Molecular formulaC7H6O2
Molecular weight123.13 g/mol
IUPAC namedeuterio benzoate
InChIKeyWPYMKLBDIGXBTP-DYCDLGHISA-N
SMILES[2H]OC(=O)C1=CC=CC=C1

Computed by PubChem (NCBI)