Products 17217-84-4
CAS 17217-84-4 is the registry number for Benzoic Acid-18O2. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg.
(18O2)benzoic acid (CAS 17217-84-4) is a chemical compound with the molecular formula C7H6O2 and a molecular weight of 126.12 g/mol. IUPAC name: (18O2)benzoic acid. InChIKey: WPYMKLBDIGXBTP-UUQIGZEMSA-N.
| Molecular formula | C7H6O2 |
|---|---|
| Molecular weight | 126.12 g/mol |
| IUPAC name | (18O2)benzoic acid |
| InChIKey | WPYMKLBDIGXBTP-UUQIGZEMSA-N |
| SMILES | C1=CC=C(C=C1)C(=[18O])[18OH] |
Computed by PubChem (NCBI)