Products 1079360-49-8

CAS 1079360-49-8 is the registry number for 2-Chloro-4-(methylsulfanyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-4-methylsulfanylbenzoic acid (CAS 1079360-49-8) is a chemical compound with the molecular formula C8H7ClO2S and a molecular weight of 202.66 g/mol. IUPAC name: 2-chloro-4-methylsulfanylbenzoic acid. InChIKey: GRUJNPZAMCELAI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO2S
Molecular weight202.66 g/mol
IUPAC name2-chloro-4-methylsulfanylbenzoic acid
InChIKeyGRUJNPZAMCELAI-UHFFFAOYSA-N
SMILESCSC1=CC(=C(C=C1)C(=O)O)Cl

Computed by PubChem (NCBI)