CAS 1079389-38-0 appears in our catalog under these names: Agomelatine-d3 (acetamide-2,2,2-d3), Agomelatine-d3 (acetamide-2,2,2-d3), 98 atom % D, min 97% Chemical Purity, Agomelatin–d3, Agomelatine-d3, 98.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg.
2,2,2-trideuterio-N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide (CAS 1079389-38-0) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 246.32 g/mol. IUPAC name: 2,2,2-trideuterio-N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide. InChIKey: YJYPHIXNFHFHND-FIBGUPNXSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 246.32 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
| InChIKey | YJYPHIXNFHFHND-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NCCC1=CC=CC2=C1C=C(C=C2)OC |
Computed by PubChem (NCBI)