Products 1079389-44-8
CAS 1079389-44-8 appears in our catalog under these names: Agomelatine-d4, >95% (HPLC), Agomelatine–d4, Agomelatine-d4. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 5mg, 25mg, 1 mg.
N-[1,1,2,2-tetradeuterio-2-(7-methoxynaphthalen-1-yl)ethyl]acetamide (CAS 1079389-44-8) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 247.32 g/mol. IUPAC name: N-[1,1,2,2-tetradeuterio-2-(7-methoxynaphthalen-1-yl)ethyl]acetamide. InChIKey: YJYPHIXNFHFHND-LZMSFWOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 247.32 g/mol |
| IUPAC name | N-[1,1,2,2-tetradeuterio-2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
| InChIKey | YJYPHIXNFHFHND-LZMSFWOYSA-N |
| SMILES | [2H]C([2H])(C1=CC=CC2=C1C=C(C=C2)OC)C([2H])([2H])NC(=O)C |
Computed by PubChem (NCBI)