Products 1079389-42-6
CAS 1079389-42-6 appears in our catalog under these names: Agomelatine-d6, Agomelatine D6, Agomelatine–d6, Agomelatine-d6, 98%, 98%, Agomelatine-d6, 98.57%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 25mg, 1mg, 5mg, 10mg, 5 mg, 1 mg, 10 mg.
2,2,2-trideuterio-N-[2-[7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide (CAS 1079389-42-6) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 249.34 g/mol. IUPAC name: 2,2,2-trideuterio-N-[2-[7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide. InChIKey: YJYPHIXNFHFHND-WFGJKAKNSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 249.34 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[2-[7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide |
| InChIKey | YJYPHIXNFHFHND-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NCCC1=CC=CC2=C1C=C(C=C2)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)