CAS 1079650-53-5 appears in our catalog under these names: (R)-1-(3,4-Dimethylphenyl)ethanamine hydrochloride, 96%, (R)–1–(3,4–Dimethylphenyl)ethanamine hydrochloride, (1R)-1-(3,4-Dimethylphenyl)ethan-1-amine hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
(1R)-1-(3,4-dimethylphenyl)ethanamine;hydrochloride (CAS 1079650-53-5) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1R)-1-(3,4-dimethylphenyl)ethanamine;hydrochloride. InChIKey: UQTBJFBMMKGXGS-SBSPUUFOSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1R)-1-(3,4-dimethylphenyl)ethanamine;hydrochloride |
| InChIKey | UQTBJFBMMKGXGS-SBSPUUFOSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@@H](C)N)C.Cl |
Computed by PubChem (NCBI)