CAS 1212186-90-7 appears in our catalog under these names: (S)-1-(3,4-Dimethylphenyl)ethanamine hydrochloride, 95%, (S)–1–(3,4–Dimethylphenyl)ethanamine hydrochloride, (1S)-1-(3,4-Dimethylphenyl)ethan-1-amine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
(1S)-1-(3,4-dimethylphenyl)ethanamine;hydrochloride (CAS 1212186-90-7) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1S)-1-(3,4-dimethylphenyl)ethanamine;hydrochloride. InChIKey: UQTBJFBMMKGXGS-FVGYRXGTSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1S)-1-(3,4-dimethylphenyl)ethanamine;hydrochloride |
| InChIKey | UQTBJFBMMKGXGS-FVGYRXGTSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@H](C)N)C.Cl |
Computed by PubChem (NCBI)