CAS 91251-28-4 appears in our catalog under these names: 1-(3,4-Dimethylphenyl)ethan-1-amine hydrochloride, 95%, 1–(3,4–Dimethylphenyl)ethan–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(3,4-dimethylphenyl)ethanamine;hydrochloride (CAS 91251-28-4) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)ethanamine;hydrochloride. InChIKey: UQTBJFBMMKGXGS-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)ethanamine;hydrochloride |
| InChIKey | UQTBJFBMMKGXGS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)N)C.Cl |
Computed by PubChem (NCBI)