CAS 1080497-35-3 is the registry number for 1-Bromo-2-methylpropane-d9, 98 atom % D, min 97% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1-bromo-1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propane (CAS 1080497-35-3) is a chemical compound with the molecular formula C4H9Br and a molecular weight of 146.07 g/mol. IUPAC name: 1-bromo-1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propane. InChIKey: HLVFKOKELQSXIQ-CBZKUFJVSA-N.
| Molecular formula | C4H9Br |
|---|---|
| Molecular weight | 146.07 g/mol |
| IUPAC name | 1-bromo-1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propane |
| InChIKey | HLVFKOKELQSXIQ-CBZKUFJVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)