Products 344299-42-9

CAS 344299-42-9 is the registry number for 1-Bromo-2-methylpropane-3,3,3-d3, 99 atom % D, min 97% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

3-bromo-1,1,1-trideuterio-2-methylpropane (CAS 344299-42-9) is a chemical compound with the molecular formula C4H9Br and a molecular weight of 140.04 g/mol. IUPAC name: 3-bromo-1,1,1-trideuterio-2-methylpropane. InChIKey: HLVFKOKELQSXIQ-FIBGUPNXSA-N.

Identity
Molecular formulaC4H9Br
Molecular weight140.04 g/mol
IUPAC name3-bromo-1,1,1-trideuterio-2-methylpropane
InChIKeyHLVFKOKELQSXIQ-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C(C)CBr

Computed by PubChem (NCBI)