CAS 108130-10-5 appears in our catalog under these names: Ethyl 2,6-dichloro-4-methylnicotinate, 95%, Ethyl 2,6-dichloro-4-methylnicotinate, 98%, Ethyl 2,6-dichloro-4-methylnicotinate 95%, Ethyl 2,6-dichloro-4-methylnicotinate, ≥95%, ≥95%, Ethyl 2,6-dichloro-4-methylnicotinate. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Ethyl 2,6-dichloro-4-methylpyridine-3-carboxylate (CAS 108130-10-5) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: ethyl 2,6-dichloro-4-methylpyridine-3-carboxylate. InChIKey: IZRKHJUVHZLWLL-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | ethyl 2,6-dichloro-4-methylpyridine-3-carboxylate |
| InChIKey | IZRKHJUVHZLWLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1C)Cl)Cl |
Computed by PubChem (NCBI)