Products 1108668-25-2
CAS 1108668-25-2 appears in our catalog under these names: Ethyl 2-amino-4,5-dichlorobenzoate, 96%, Ethyl 2-amino-4,5-dichlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
Ethyl 2-amino-4,5-dichlorobenzoate (CAS 1108668-25-2) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: ethyl 2-amino-4,5-dichlorobenzoate. InChIKey: YCSGBGFAINYTPQ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | ethyl 2-amino-4,5-dichlorobenzoate |
| InChIKey | YCSGBGFAINYTPQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1N)Cl)Cl |
Computed by PubChem (NCBI)