Products 5472-67-3
CAS 5472-67-3 appears in our catalog under these names: 2–Amino–3–(3,4–dichlorophenyl)propanoic acid, 2-Amino-3-(3,4-dichlorophenyl)propanoic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 5g, 1g.
2-amino-3-(3,4-dichlorophenyl)propanoic acid (CAS 5472-67-3) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 2-amino-3-(3,4-dichlorophenyl)propanoic acid. InChIKey: NRCSJHVDTAAISV-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2-amino-3-(3,4-dichlorophenyl)propanoic acid |
| InChIKey | NRCSJHVDTAAISV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)Cl)Cl |
Computed by PubChem (NCBI)