CAS 108149-61-7 is the registry number for 3-(1,1-Dimethylethyl) 4-methyl (4S,5R)-2,2,5-trimethyl-3,4-oxazolidinedicarboxylate. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
3-O-tert-butyl 4-O-methyl (4S,5R)-2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate (CAS 108149-61-7) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl (4S,5R)-2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate. InChIKey: FRSJJRXFHYGDSO-BDAKNGLRSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 3-O-tert-butyl 4-O-methyl (4S,5R)-2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate |
| InChIKey | FRSJJRXFHYGDSO-BDAKNGLRSA-N |
| SMILES | C[C@@H]1[C@H](N(C(O1)(C)C)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)