CAS 1081765-44-7 appears in our catalog under these names: (E)-3-(4-Fluoro-3-methoxyphenyl)acrylic acid, 98%, (2E)-3-(4-Fluoro-3-methoxyphenyl)prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
(E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoic acid (CAS 1081765-44-7) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoic acid. InChIKey: NVEDFCULNXTLOA-HWKANZROSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoic acid |
| InChIKey | NVEDFCULNXTLOA-HWKANZROSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)