Products 1082041-60-8
CAS 1082041-60-8 appears in our catalog under these names: 6-Methoxy-1h-indazole-5-carboxylic acid, 95%, 6–Methoxy–1H–indazole–5–carboxylic acid, 6-Methoxy-1H-indazole-5-carboxylic acid, 6-Methoxy-1H-indazole-5-carboxylic acid, 96%, 96%, 6-Methoxy-1H-indazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 2,5g, 100mg, 5g.
6-methoxy-1H-indazole-5-carboxylic acid (CAS 1082041-60-8) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 6-methoxy-1H-indazole-5-carboxylic acid. InChIKey: YTPLCCONLYBFTE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6-methoxy-1H-indazole-5-carboxylic acid |
| InChIKey | YTPLCCONLYBFTE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=NNC2=C1)C(=O)O |
Computed by PubChem (NCBI)