CAS 1082167-93-8 is the registry number for 5-(2,3-Dimethylphenoxy)furan-2-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,3-dimethylphenoxy)furan-2-carbaldehyde (CAS 1082167-93-8) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: 5-(2,3-dimethylphenoxy)furan-2-carbaldehyde. InChIKey: CQMWSXRHNZCJGW-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 5-(2,3-dimethylphenoxy)furan-2-carbaldehyde |
| InChIKey | CQMWSXRHNZCJGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OC2=CC=C(O2)C=O)C |
Computed by PubChem (NCBI)