CAS 108349-64-0 appears in our catalog under these names: N4-(4-Fluorophenyl)pyridine-3,4-diamine, 95%, 4-N-(4-Fluorophenyl)pyridine-3,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-N-(4-fluorophenyl)pyridine-3,4-diamine (CAS 108349-64-0) is a chemical compound with the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. IUPAC name: 4-N-(4-fluorophenyl)pyridine-3,4-diamine. InChIKey: YWFXJNSRFLGLHP-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3 |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | 4-N-(4-fluorophenyl)pyridine-3,4-diamine |
| InChIKey | YWFXJNSRFLGLHP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=C(C=NC=C2)N)F |
Computed by PubChem (NCBI)