Products 1249530-62-8
CAS 1249530-62-8 is the registry number for 6-(4-Fluorophenyl)-2-methylpyrimidin-4-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6-(4-fluorophenyl)-2-methylpyrimidin-4-amine (CAS 1249530-62-8) is a chemical compound with the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. IUPAC name: 6-(4-fluorophenyl)-2-methylpyrimidin-4-amine. InChIKey: KKHQONCCNIVZJE-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3 |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | 6-(4-fluorophenyl)-2-methylpyrimidin-4-amine |
| InChIKey | KKHQONCCNIVZJE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)