Products 2982687-39-6
CAS 2982687-39-6 appears in our catalog under these names: 2-Methyl-1,4-dioxane-2-carboxylic acid, 97%, 97%, 3-(5-Fluoropyrimidin-2-yl)-4-methylaniline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-(5-fluoropyrimidin-2-yl)-4-methylaniline (CAS 2982687-39-6) is a chemical compound with the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. IUPAC name: 3-(5-fluoropyrimidin-2-yl)-4-methylaniline. InChIKey: SEIDOUJHHMRSAH-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3 |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | 3-(5-fluoropyrimidin-2-yl)-4-methylaniline |
| InChIKey | SEIDOUJHHMRSAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)C2=NC=C(C=N2)F |
Computed by PubChem (NCBI)