CAS 1942890-85-8 is the registry number for 3-(4-Fluorophenyl)pyridine-2,6-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-fluorophenyl)pyridine-2,6-diamine (CAS 1942890-85-8) is a chemical compound with the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. IUPAC name: 3-(4-fluorophenyl)pyridine-2,6-diamine. InChIKey: WXTREOZKACFMAI-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3 |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | 3-(4-fluorophenyl)pyridine-2,6-diamine |
| InChIKey | WXTREOZKACFMAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=C(C=C2)N)N)F |
Computed by PubChem (NCBI)