CAS 41010-70-2 appears in our catalog under these names: 2-N-(4-Fluorophenyl)pyridine-2,3-diamine, N2-(4-Fluorophenyl)pyridine-2,3-diamine, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
2-N-(4-fluorophenyl)pyridine-2,3-diamine (CAS 41010-70-2) is a chemical compound with the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. IUPAC name: 2-N-(4-fluorophenyl)pyridine-2,3-diamine. InChIKey: KANSXBGVFUJMTJ-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3 |
|---|---|
| Molecular weight | 203.22 g/mol |
| IUPAC name | 2-N-(4-fluorophenyl)pyridine-2,3-diamine |
| InChIKey | KANSXBGVFUJMTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NC2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)