CAS 108354-48-9 is the registry number for 2-Amino-3,4-dimethylimidazo(4,5-f)quinoxaline. Offered by: TRC. Available pack sizes: 500mg.
3,4-dimethylimidazo[4,5-f]quinoxalin-2-amine (CAS 108354-48-9) is a chemical compound with the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. IUPAC name: 3,4-dimethylimidazo[4,5-f]quinoxalin-2-amine. InChIKey: NCJALZQHQFQOPX-UHFFFAOYSA-N.
| Molecular formula | C11H11N5 |
|---|---|
| Molecular weight | 213.24 g/mol |
| IUPAC name | 3,4-dimethylimidazo[4,5-f]quinoxalin-2-amine |
| InChIKey | NCJALZQHQFQOPX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=CN=C2C3=C1N(C(=N3)N)C |
Computed by PubChem (NCBI)