CAS 879615-84-6 is the registry number for 4-(2,3-Dihydro-1h-indol-1-yl)-1,3,5-triazin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-amine (CAS 879615-84-6) is a chemical compound with the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. IUPAC name: 4-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-amine. InChIKey: AVAFAFDOURGYKI-UHFFFAOYSA-N.
| Molecular formula | C11H11N5 |
|---|---|
| Molecular weight | 213.24 g/mol |
| IUPAC name | 4-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-amine |
| InChIKey | AVAFAFDOURGYKI-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C3=NC=NC(=N3)N |
Computed by PubChem (NCBI)