CAS 934333-16-1 is the registry number for 1,7-Dimethyl-1H-imidazo(4,5-g)quinoxalin-2-amine. Offered by: TRC. Available pack sizes: 100mg.
3,6-dimethylimidazo[4,5-g]quinoxalin-2-amine (CAS 934333-16-1) is a chemical compound with the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. IUPAC name: 3,6-dimethylimidazo[4,5-g]quinoxalin-2-amine. InChIKey: VDYWCSWBQPTHDB-UHFFFAOYSA-N.
| Molecular formula | C11H11N5 |
|---|---|
| Molecular weight | 213.24 g/mol |
| IUPAC name | 3,6-dimethylimidazo[4,5-g]quinoxalin-2-amine |
| InChIKey | VDYWCSWBQPTHDB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC3=C(C=C2N=C1)N=C(N3C)N |
Computed by PubChem (NCBI)