Products 65796-36-3
CAS 65796-36-3 is the registry number for 8-Methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine (CAS 65796-36-3) is a chemical compound with the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. IUPAC name: 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine. InChIKey: TVZWUWIEIFOOSS-UHFFFAOYSA-N.
| Molecular formula | C11H11N5 |
|---|---|
| Molecular weight | 213.24 g/mol |
| IUPAC name | 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
| InChIKey | TVZWUWIEIFOOSS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=CC3=C2C(=NC(=N3)N)N |
Computed by PubChem (NCBI)