CAS 1287380-98-6 appears in our catalog under these names: Phenazopyridin-d5, Phenazopyridine-d5. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]pyridine-2,6-diamine (CAS 1287380-98-6) is a chemical compound with the molecular formula C11H11N5 and a molecular weight of 218.27 g/mol. IUPAC name: 3-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]pyridine-2,6-diamine. InChIKey: QPFYXYFORQJZEC-RALIUCGRSA-N.
| Molecular formula | C11H11N5 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 3-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]pyridine-2,6-diamine |
| InChIKey | QPFYXYFORQJZEC-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N=NC2=C(N=C(C=C2)N)N)[2H])[2H] |
Computed by PubChem (NCBI)