Products 108446-77-1
CAS 108446-77-1 appears in our catalog under these names: 3-(1,3-diphenylpyrazol-4-yl)propanoic acid, 98%, 3-(1,3-Diphenyl-1H-pyrazol-4-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-(1,3-diphenylpyrazol-4-yl)propanoic acid (CAS 108446-77-1) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: 3-(1,3-diphenylpyrazol-4-yl)propanoic acid. InChIKey: LMHUSEBWZSOLAN-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 3-(1,3-diphenylpyrazol-4-yl)propanoic acid |
| InChIKey | LMHUSEBWZSOLAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2CCC(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)