Products 372107-16-9

CAS 372107-16-9 is the registry number for 3-(4-Ethylphenyl)-1-phenyl-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(4-ethylphenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 372107-16-9) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: 3-(4-ethylphenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: SKCJKBXIMKWSQV-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16N2O2
Molecular weight292.3 g/mol
IUPAC name3-(4-ethylphenyl)-1-phenylpyrazole-4-carboxylic acid
InChIKeySKCJKBXIMKWSQV-UHFFFAOYSA-N
SMILESCCC1=CC=C(C=C1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)