Products 590357-65-6
CAS 590357-65-6 appears in our catalog under these names: 2-(4-Aminophenyl)-6,8-dimethylquinoline-4-carboxylic acid, 95%, 2-(4-Aminophenyl)-6,8-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(4-aminophenyl)-6,8-dimethylquinoline-4-carboxylic acid (CAS 590357-65-6) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: 2-(4-aminophenyl)-6,8-dimethylquinoline-4-carboxylic acid. InChIKey: WUPJJQNVOFIMRD-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 2-(4-aminophenyl)-6,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | WUPJJQNVOFIMRD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)N)C(=O)O)C |
Computed by PubChem (NCBI)