CAS 956453-12-6 is the registry number for 1-Benzyl-3-(4-methylphenyl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-benzyl-3-(4-methylphenyl)pyrazole-4-carboxylic acid (CAS 956453-12-6) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: 1-benzyl-3-(4-methylphenyl)pyrazole-4-carboxylic acid. InChIKey: LPXNEXTXAIVFDK-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 1-benzyl-3-(4-methylphenyl)pyrazole-4-carboxylic acid |
| InChIKey | LPXNEXTXAIVFDK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN(C=C2C(=O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)