Products 956753-11-0
CAS 956753-11-0 appears in our catalog under these names: 3-(3,4-Dimethylphenyl)-1-phenyl-1h-pyrazole-4-carboxylic acid, 95%, 3-(3,4-Dimethylphenyl)-1-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 2g.
3-(3,4-dimethylphenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 956753-11-0) is a chemical compound with the molecular formula C18H16N2O2 and a molecular weight of 292.3 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: MHEIVZUPCFKWOT-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | MHEIVZUPCFKWOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)