CAS 108536-18-1 appears in our catalog under these names: 1,4-dimethoxy-2-[(E)-2-nitroethenyl]benzene, ≥97%, ≥97%, (E)-1,4-Dimethoxy-2-(2-nitrovinyl)benzene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1,4-dimethoxy-2-[(E)-2-nitroethenyl]benzene (CAS 108536-18-1) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 1,4-dimethoxy-2-[(E)-2-nitroethenyl]benzene. InChIKey: IRRZIWHEPWPPJF-AATRIKPKSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 1,4-dimethoxy-2-[(E)-2-nitroethenyl]benzene |
| InChIKey | IRRZIWHEPWPPJF-AATRIKPKSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)