Products 108551-59-3

CAS 108551-59-3 appears in our catalog under these names: 5-Ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid, 95%, 5-Ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 108551-59-3) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 5-ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: CBEHCCOHAWHFCL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name5-ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid
InChIKeyCBEHCCOHAWHFCL-UHFFFAOYSA-N
SMILESCCC1=CC2=C(C(=C1)C(=O)O)OCC2

Computed by PubChem (NCBI)