CAS 108551-59-3 appears in our catalog under these names: 5-Ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid, 95%, 5-Ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 108551-59-3) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 5-ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: CBEHCCOHAWHFCL-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 5-ethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | CBEHCCOHAWHFCL-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C(=C1)C(=O)O)OCC2 |
Computed by PubChem (NCBI)