Products 1086379-56-7
CAS 1086379-56-7 is the registry number for 4-(5-Bromopyrimidin-2-yloxy)benzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
4-(5-bromopyrimidin-2-yl)oxybenzoic acid (CAS 1086379-56-7) is a chemical compound with the molecular formula C11H7BrN2O3 and a molecular weight of 295.09 g/mol. IUPAC name: 4-(5-bromopyrimidin-2-yl)oxybenzoic acid. InChIKey: BGVNFFKTAKKZBC-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2O3 |
|---|---|
| Molecular weight | 295.09 g/mol |
| IUPAC name | 4-(5-bromopyrimidin-2-yl)oxybenzoic acid |
| InChIKey | BGVNFFKTAKKZBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)